C17H25NO3 — CID 99991877
2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethoxy]-3-methoxybenzaldehyde (PubChem CID 99991877) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethoxy]-3-methoxybenzaldehyde.
| Compound Name | 2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 99991877 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]ethoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cccc(C=O)c1OCCN1[C@@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C17H25NO3/c1-13-6-4-7-14(2)18(13)10-11-21-17-15(12-19)8-5-9-16(17)20-3/h5,8-9,12-14H,4,6-7,10-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | QENPFQRUWYTOOE-KBPBESRZSA-N |
| XLogP | 3.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|