C19H30NO3+ — CID 7380103
2-[4-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]-3-methoxybenzaldehyde (PubChem CID 7380103) has the molecular formula C19H30NO3+ and a molecular weight of 320.45 g/mol. Its IUPAC name is 2-[4-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]-3-methoxybenzaldehyde.
| Compound Name | 2-[4-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 7380103 |
| Molecular Formula | C19H30NO3+ |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-[4-[(3S,5S)-3,5-dimethylpiperidin-1-ium-1-yl]butoxy]-3-methoxybenzaldehyde |
| SMILES | COc1cccc(C=O)c1OCCCC[NH+]1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C19H29NO3/c1-15-11-16(2)13-20(12-15)9-4-5-10-23-19-17(14-21)7-6-8-18(19)22-3/h6-8,14-16H,4-5,9-13H2,1-3H3/p+1/t15-,16-/m0/s1 |
| InChIKey | AKJFEVXBGULWHZ-HOTGVXAUSA-O |
| XLogP | 2.23 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|