C16H24NO2+ — CID 7379355
2-[3-[(3S)-3-methylpiperidin-1-ium-1-yl]propoxy]benzaldehyde (PubChem CID 7379355) has the molecular formula C16H24NO2+ and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[3-[(3S)-3-methylpiperidin-1-ium-1-yl]propoxy]benzaldehyde.
| Compound Name | 2-[3-[(3S)-3-methylpiperidin-1-ium-1-yl]propoxy]benzaldehyde |
|---|---|
| PubChem CID | 7379355 |
| Molecular Formula | C16H24NO2+ |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 2-[3-[(3S)-3-methylpiperidin-1-ium-1-yl]propoxy]benzaldehyde |
| SMILES | C[C@H]1CCC[NH+](CCCOc2ccccc2C=O)C1 |
| InChI | InChI=1S/C16H23NO2/c1-14-6-4-9-17(12-14)10-5-11-19-16-8-3-2-7-15(16)13-18/h2-3,7-8,13-14H,4-6,9-12H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | NFZNCLYYQZNOCZ-AWEZNQCLSA-O |
| XLogP | 1.58 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|