C17H28NO3+ — CID 2262417
1-[4-(2,6-dimethoxyphenoxy)butyl]piperidin-1-ium (PubChem CID 2262417) has the molecular formula C17H28NO3+ and a molecular weight of 294.41 g/mol. Its IUPAC name is 1-[4-(2,6-dimethoxyphenoxy)butyl]piperidin-1-ium.
| Compound Name | 1-[4-(2,6-dimethoxyphenoxy)butyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2262417 |
| Molecular Formula | C17H28NO3+ |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-[4-(2,6-dimethoxyphenoxy)butyl]piperidin-1-ium |
| SMILES | COc1cccc(OC)c1OCCCC[NH+]1CCCCC1 |
| InChI | InChI=1S/C17H27NO3/c1-19-15-9-8-10-16(20-2)17(15)21-14-7-6-13-18-11-4-3-5-12-18/h8-10H,3-7,11-14H2,1-2H3/p+1 |
| InChIKey | OVPYVVBUWIIPLO-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|