C25H37N2O4+ — CID 4536710
1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-(2-methoxyphenyl)piperazin-1-ium (PubChem CID 4536710) has the molecular formula C25H37N2O4+ and a molecular weight of 429.58 g/mol. Its IUPAC name is 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-(2-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-(2-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 4536710 |
| Molecular Formula | C25H37N2O4+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1-[6-(2,6-dimethoxyphenoxy)hexyl]-4-(2-methoxyphenyl)piperazin-1-ium |
| SMILES | COc1ccccc1N1CC[NH+](CCCCCCOc2c(OC)cccc2OC)CC1 |
| InChI | InChI=1S/C25H36N2O4/c1-28-22-12-7-6-11-21(22)27-18-16-26(17-19-27)15-8-4-5-9-20-31-25-23(29-2)13-10-14-24(25)30-3/h6-7,10-14H,4-5,8-9,15-20H2,1-3H3/p+1 |
| InChIKey | HAHLLJRKAUQGPT-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 44.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|