C22H29ClN3O2+ — CID 7211458
4-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]butyl]benzamide (PubChem CID 7211458) has the molecular formula C22H29ClN3O2+ and a molecular weight of 402.95 g/mol. Its IUPAC name is 4-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]butyl]benzamide.
| Compound Name | 4-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 7211458 |
| Molecular Formula | C22H29ClN3O2+ |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-chloro-N-[4-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]butyl]benzamide |
| SMILES | COc1ccccc1N1CC[NH+](CCCCNC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H28ClN3O2/c1-28-21-7-3-2-6-20(21)26-16-14-25(15-17-26)13-5-4-12-24-22(27)18-8-10-19(23)11-9-18/h2-3,6-11H,4-5,12-17H2,1H3,(H,24,27)/p+1 |
| InChIKey | PZWHEQIOEMDZEH-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|