C22H31N4O5S+ — CID 9499127
2-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propyl]-5-sulfamoylbenzamide (PubChem CID 9499127) has the molecular formula C22H31N4O5S+ and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propyl]-5-sulfamoylbenzamide.
| Compound Name | 2-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9499127 |
| Molecular Formula | C22H31N4O5S+ |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 2-methoxy-N-[3-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]propyl]-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCCC[NH+]1CCN(c2ccccc2OC)CC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-30-20-9-8-17(32(23,28)29)16-18(20)22(27)24-10-5-11-25-12-14-26(15-13-25)19-6-3-4-7-21(19)31-2/h3-4,6-9,16H,5,10-15H2,1-2H3,(H,24,27)(H2,23,28,29)/p+1 |
| InChIKey | XLVOIVRFRFZPTR-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|