C14H20N2O4S — CID 115687261
N-(2-cyclobutylethyl)-2-methoxy-5-sulfamoylbenzamide (PubChem CID 115687261) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(2-cyclobutylethyl)-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-(2-cyclobutylethyl)-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115687261 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-cyclobutylethyl)-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCCC1CCC1 |
| InChI | InChI=1S/C14H20N2O4S/c1-20-13-6-5-11(21(15,18)19)9-12(13)14(17)16-8-7-10-3-2-4-10/h5-6,9-10H,2-4,7-8H2,1H3,(H,16,17)(H2,15,18,19) |
| InChIKey | MDFLBEFAPAFWNP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |