C22H30N2O4S — CID 9162988
N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-methoxy-5-sulfamoylbenzamide (PubChem CID 9162988) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-methoxy-5-sulfamoylbenzamide.
| Compound Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-methoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9162988 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[2-(4-tert-butyl-2,6-dimethylphenyl)ethyl]-2-methoxy-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCCc1c(C)cc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C22H30N2O4S/c1-14-11-16(22(3,4)5)12-15(2)18(14)9-10-24-21(25)19-13-17(29(23,26)27)7-8-20(19)28-6/h7-8,11-13H,9-10H2,1-6H3,(H,24,25)(H2,23,26,27) |
| InChIKey | CCXZGHZLQSEIGT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |