C14H22N2O5S — CID 9292499
2-methoxy-N-(3-propan-2-yloxypropyl)-5-sulfamoylbenzamide (PubChem CID 9292499) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-methoxy-N-(3-propan-2-yloxypropyl)-5-sulfamoylbenzamide.
| Compound Name | 2-methoxy-N-(3-propan-2-yloxypropyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 9292499 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-methoxy-N-(3-propan-2-yloxypropyl)-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C14H22N2O5S/c1-10(2)21-8-4-7-16-14(17)12-9-11(22(15,18)19)5-6-13(12)20-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,16,17)(H2,15,18,19) |
| InChIKey | BOVFCSNJKIUXTN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|