C19H28N2O7 — CID 2951012
3-methoxy-2-[4-(4-methylpiperazin-1-yl)butoxy]benzaldehyde;oxalic acid (PubChem CID 2951012) has the molecular formula C19H28N2O7 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-methoxy-2-[4-(4-methylpiperazin-1-yl)butoxy]benzaldehyde;oxalic acid.
| Compound Name | 3-methoxy-2-[4-(4-methylpiperazin-1-yl)butoxy]benzaldehyde;oxalic acid |
|---|---|
| PubChem CID | 2951012 |
| Molecular Formula | C19H28N2O7 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-methoxy-2-[4-(4-methylpiperazin-1-yl)butoxy]benzaldehyde;oxalic acid |
| SMILES | COc1cccc(C=O)c1OCCCCN1CCN(C)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H26N2O3.C2H2O4/c1-18-9-11-19(12-10-18)8-3-4-13-22-17-15(14-20)6-5-7-16(17)21-2;3-1(4)2(5)6/h5-7,14H,3-4,8-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | ZNWMLDZHZBEYLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|