C16H24Cl2NO2+ — CID 2184510
(3S)-1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium (PubChem CID 2184510) has the molecular formula C16H24Cl2NO2+ and a molecular weight of 333.28 g/mol. Its IUPAC name is (3S)-1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium.
| Compound Name | (3S)-1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 2184510 |
| Molecular Formula | C16H24Cl2NO2+ |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (3S)-1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]-3-methylpiperidin-1-ium |
| SMILES | C[C@H]1CCC[NH+](CCOCCOc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H23Cl2NO2/c1-13-3-2-6-19(12-13)7-8-20-9-10-21-14-4-5-15(17)16(18)11-14/h4-5,11,13H,2-3,6-10,12H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | XSKHKJBWMOZMEE-ZDUSSCGKSA-O |
| XLogP | 2.70 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|