C14H19Cl2NO2 — CID 2581947
1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]pyrrolidine (PubChem CID 2581947) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is 1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 2581947 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-[2-[2-(3,4-dichlorophenoxy)ethoxy]ethyl]pyrrolidine |
| SMILES | Clc1ccc(OCCOCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2/c15-13-4-3-12(11-14(13)16)19-10-9-18-8-7-17-5-1-2-6-17/h3-4,11H,1-2,5-10H2 |
| InChIKey | IAGIBINJWTWUBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|