C14H16Cl2N2O — CID 39420280
1-[2-(3,4-dichlorophenoxy)ethyl]piperidine-4-carbonitrile (PubChem CID 39420280) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenoxy)ethyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-(3,4-dichlorophenoxy)ethyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 39420280 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-[2-(3,4-dichlorophenoxy)ethyl]piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(CCOc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O/c15-13-2-1-12(9-14(13)16)19-8-7-18-5-3-11(10-17)4-6-18/h1-2,9,11H,3-8H2 |
| InChIKey | MRQGYBVUKGIURG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |