C16H22N2O — CID 39359835
1-[2-(3,4-dimethylphenoxy)ethyl]piperidine-4-carbonitrile (PubChem CID 39359835) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)ethyl]piperidine-4-carbonitrile.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)ethyl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 39359835 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)ethyl]piperidine-4-carbonitrile |
| SMILES | Cc1ccc(OCCN2CCC(C#N)CC2)cc1C |
| InChI | InChI=1S/C16H22N2O/c1-13-3-4-16(11-14(13)2)19-10-9-18-7-5-15(12-17)6-8-18/h3-4,11,15H,5-10H2,1-2H3 |
| InChIKey | PSPRBQRPGBCRJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |