C15H23NO3 — CID 106672455
1-[3-(3,4-dimethylphenoxy)propyl]pyrrolidine-3,4-diol (PubChem CID 106672455) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-[3-(3,4-dimethylphenoxy)propyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[3-(3,4-dimethylphenoxy)propyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672455 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-[3-(3,4-dimethylphenoxy)propyl]pyrrolidine-3,4-diol |
| SMILES | Cc1ccc(OCCCN2CC(O)C(O)C2)cc1C |
| InChI | InChI=1S/C15H23NO3/c1-11-4-5-13(8-12(11)2)19-7-3-6-16-9-14(17)15(18)10-16/h4-5,8,14-15,17-18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | MIEXVBXJKSLYBE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|