C13H19NO3 — CID 79410528
(3S,4R)-1-(3-phenoxypropyl)pyrrolidine-3,4-diol (PubChem CID 79410528) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3S,4R)-1-(3-phenoxypropyl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(3-phenoxypropyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410528 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (3S,4R)-1-(3-phenoxypropyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(CCCOc2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C13H19NO3/c15-12-9-14(10-13(12)16)7-4-8-17-11-5-2-1-3-6-11/h1-3,5-6,12-13,15-16H,4,7-10H2/t12-,13+ |
| InChIKey | GTFUMFPOTIFFKF-BETUJISGSA-N |
| XLogP | 0.49 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|