C17H28Cl2N2O — CID 154908285
(1S,5R)-3-(4-phenoxybutyl)-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride (PubChem CID 154908285) has the molecular formula C17H28Cl2N2O and a molecular weight of 347.33 g/mol. Its IUPAC name is (1S,5R)-3-(4-phenoxybutyl)-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride.
| Compound Name | (1S,5R)-3-(4-phenoxybutyl)-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride |
|---|---|
| PubChem CID | 154908285 |
| Molecular Formula | C17H28Cl2N2O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (1S,5R)-3-(4-phenoxybutyl)-3-azabicyclo[3.2.1]octan-8-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1[C@@H]2CC[C@H]1CN(CCCCOc1ccccc1)C2 |
| InChI | InChI=1S/C17H26N2O.2ClH/c18-17-14-8-9-15(17)13-19(12-14)10-4-5-11-20-16-6-2-1-3-7-16;;/h1-3,6-7,14-15,17H,4-5,8-13,18H2;2*1H/t14-,15+,17?;; |
| InChIKey | FLWREMBNOUUKHH-AAIZQAJISA-N |
| XLogP | 3.36 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|