C14H18N2O3 — CID 106669453
3-[3-(3,4-dihydroxypyrrolidin-1-yl)propoxy]benzonitrile (PubChem CID 106669453) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[3-(3,4-dihydroxypyrrolidin-1-yl)propoxy]benzonitrile.
| Compound Name | 3-[3-(3,4-dihydroxypyrrolidin-1-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 106669453 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[3-(3,4-dihydroxypyrrolidin-1-yl)propoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCCN2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C14H18N2O3/c15-8-11-3-1-4-12(7-11)19-6-2-5-16-9-13(17)14(18)10-16/h1,3-4,7,13-14,17-18H,2,5-6,9-10H2 |
| InChIKey | GHVKSYPWOXEHCY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|