C19H20N2O — CID 112824313
3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]benzonitrile (PubChem CID 112824313) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]benzonitrile.
| Compound Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 112824313 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 3-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCCN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C19H20N2O/c20-14-16-5-3-8-19(13-16)22-12-4-10-21-11-9-17-6-1-2-7-18(17)15-21/h1-3,5-8,13H,4,9-12,15H2 |
| InChIKey | XKGIMJWIYIHRHG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|