C16H25NO — CID 82086608
1-[2-(3,4-dimethylphenoxy)ethyl]azepane (PubChem CID 82086608) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-[2-(3,4-dimethylphenoxy)ethyl]azepane.
| Compound Name | 1-[2-(3,4-dimethylphenoxy)ethyl]azepane |
|---|---|
| PubChem CID | 82086608 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-[2-(3,4-dimethylphenoxy)ethyl]azepane |
| SMILES | Cc1ccc(OCCN2CCCCCC2)cc1C |
| InChI | InChI=1S/C16H25NO/c1-14-7-8-16(13-15(14)2)18-12-11-17-9-5-3-4-6-10-17/h7-8,13H,3-6,9-12H2,1-2H3 |
| InChIKey | VISBPAMSZVHGJI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |