C14H20Cl2NO+ — CID 7381393
1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperidin-1-ium (PubChem CID 7381393) has the molecular formula C14H20Cl2NO+ and a molecular weight of 289.23 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 7381393 |
| Molecular Formula | C14H20Cl2NO+ |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[2-(3,4-dichlorophenoxy)ethyl]-4-methylpiperidin-1-ium |
| SMILES | CC1CC[NH+](CCOc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-11-4-6-17(7-5-11)8-9-18-12-2-3-13(15)14(16)10-12/h2-3,10-11H,4-9H2,1H3/p+1 |
| InChIKey | YBNZHOBCZGSLGG-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |