C18H30NO+ — CID 2269412
1-[4-(3,4-dimethylphenoxy)butyl]-4-methylpiperidin-1-ium (PubChem CID 2269412) has the molecular formula C18H30NO+ and a molecular weight of 276.44 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenoxy)butyl]-4-methylpiperidin-1-ium.
| Compound Name | 1-[4-(3,4-dimethylphenoxy)butyl]-4-methylpiperidin-1-ium |
|---|---|
| PubChem CID | 2269412 |
| Molecular Formula | C18H30NO+ |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 1-[4-(3,4-dimethylphenoxy)butyl]-4-methylpiperidin-1-ium |
| SMILES | Cc1ccc(OCCCC[NH+]2CCC(C)CC2)cc1C |
| InChI | InChI=1S/C18H29NO/c1-15-8-11-19(12-9-15)10-4-5-13-20-18-7-6-16(2)17(3)14-18/h6-7,14-15H,4-5,8-13H2,1-3H3/p+1 |
| InChIKey | HSPOZVZAAMLVHE-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|