C16H24O2 — CID 165029250
4-[3-(3,4-dimethylphenoxy)propyl]oxane (PubChem CID 165029250) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenoxy)propyl]oxane.
| Compound Name | 4-[3-(3,4-dimethylphenoxy)propyl]oxane |
|---|---|
| PubChem CID | 165029250 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 4-[3-(3,4-dimethylphenoxy)propyl]oxane |
| SMILES | Cc1ccc(OCCCC2CCOCC2)cc1C |
| InChI | InChI=1S/C16H24O2/c1-13-5-6-16(12-14(13)2)18-9-3-4-15-7-10-17-11-8-15/h5-6,12,15H,3-4,7-11H2,1-2H3 |
| InChIKey | NCNAAIYZHDJRAO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|