C12H15Cl2N3O — CID 122097203
N-[2-(3,4-dichlorophenoxy)ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 122097203) has the molecular formula C12H15Cl2N3O and a molecular weight of 288.18 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenoxy)ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[2-(3,4-dichlorophenoxy)ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 122097203 |
| Molecular Formula | C12H15Cl2N3O |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-[2-(3,4-dichlorophenoxy)ethyl]-5-methyl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1CN=C(NCCOc2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C12H15Cl2N3O/c1-8-7-16-12(17-8)15-4-5-18-9-2-3-10(13)11(14)6-9/h2-3,6,8H,4-5,7H2,1H3,(H2,15,16,17) |
| InChIKey | MIXLGLJITXPMAD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|