C15H24Cl2N2O+2 — CID 2580968
1-[4-(3,4-dichlorophenoxy)butyl]-4-methylpiperazine-1,4-diium (PubChem CID 2580968) has the molecular formula C15H24Cl2N2O+2 and a molecular weight of 319.28 g/mol. Its IUPAC name is 1-[4-(3,4-dichlorophenoxy)butyl]-4-methylpiperazine-1,4-diium.
| Compound Name | 1-[4-(3,4-dichlorophenoxy)butyl]-4-methylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 2580968 |
| Molecular Formula | C15H24Cl2N2O+2 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-[4-(3,4-dichlorophenoxy)butyl]-4-methylpiperazine-1,4-diium |
| SMILES | C[NH+]1CC[NH+](CCCCOc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c1-18-7-9-19(10-8-18)6-2-3-11-20-13-4-5-14(16)15(17)12-13/h4-5,12H,2-3,6-11H2,1H3/p+2 |
| InChIKey | HAMMZRJYEXKPSG-UHFFFAOYSA-P |
| XLogP | 0.57 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|