C10H11BrCl2O — CID 18768634
4-(4-bromobutoxy)-1,2-dichlorobenzene (PubChem CID 18768634) has the molecular formula C10H11BrCl2O and a molecular weight of 298.01 g/mol. Its IUPAC name is 4-(4-bromobutoxy)-1,2-dichlorobenzene.
| Compound Name | 4-(4-bromobutoxy)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 18768634 |
| Molecular Formula | C10H11BrCl2O |
| Molecular Weight | 298.01 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | 4-(4-bromobutoxy)-1,2-dichlorobenzene |
| SMILES | Clc1ccc(OCCCCBr)cc1Cl |
| InChI | InChI=1S/C10H11BrCl2O/c11-5-1-2-6-14-8-3-4-9(12)10(13)7-8/h3-4,7H,1-2,5-6H2 |
| InChIKey | KAJYQHYWCDUIFV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|