About 4-(bromomethoxy)-1,2-dichlorobenzene
4-(bromomethoxy)-1,2-dichlorobenzene (PubChem CID 22961270) has the molecular formula C7H5BrCl2O
and a molecular weight of 255.93 g/mol. Its IUPAC name is 4-(bromomethoxy)-1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 4-(bromomethoxy)-1,2-dichlorobenzene |
| PubChem CID | 22961270 |
| Molecular Formula | C7H5BrCl2O |
| Molecular Weight | 255.93 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 4-(bromomethoxy)-1,2-dichlorobenzene |
| SMILES | Clc1ccc(OCBr)cc1Cl |
| InChI | InChI=1S/C7H5BrCl2O/c8-4-11-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| InChIKey | IQYIUROQJVZCDH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethoxy)-1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethoxy)-1,2-dichlorobenzene?
The IUPAC name of 4-(bromomethoxy)-1,2-dichlorobenzene (CID 22961270) is 4-(bromomethoxy)-1,2-dichlorobenzene.
What is the SMILES notation for 4-(bromomethoxy)-1,2-dichlorobenzene?
The canonical SMILES for 4-(bromomethoxy)-1,2-dichlorobenzene is Clc1ccc(OCBr)cc1Cl.
What is the InChIKey of 4-(bromomethoxy)-1,2-dichlorobenzene?
The InChIKey is IQYIUROQJVZCDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrCl2O/c8-4-11-5-1-2-6(9)7(10)3-5/h1-3H,4H2.
What are the key properties of 4-(bromomethoxy)-1,2-dichlorobenzene?
4-(bromomethoxy)-1,2-dichlorobenzene has a molecular weight of 255.93 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethoxy)-1,2-dichlorobenzene is sourced from PubChem (CID 22961270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).