C7H5BrCl2O — CID 22961270
4-(bromomethoxy)-1,2-dichlorobenzene (PubChem CID 22961270) has the molecular formula C7H5BrCl2O and a molecular weight of 255.93 g/mol. Its IUPAC name is 4-(bromomethoxy)-1,2-dichlorobenzene.
| Compound Name | 4-(bromomethoxy)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 22961270 |
| Molecular Formula | C7H5BrCl2O |
| Molecular Weight | 255.93 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 4-(bromomethoxy)-1,2-dichlorobenzene |
| SMILES | Clc1ccc(OCBr)cc1Cl |
| InChI | InChI=1S/C7H5BrCl2O/c8-4-11-5-1-2-6(9)7(10)3-5/h1-3H,4H2 |
| InChIKey | IQYIUROQJVZCDH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.93 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|