C9H9BrCl2O — CID 14773496
4-(1-bromopropan-2-yloxy)-1,2-dichlorobenzene (PubChem CID 14773496) has the molecular formula C9H9BrCl2O and a molecular weight of 283.98 g/mol. Its IUPAC name is 4-(1-bromopropan-2-yloxy)-1,2-dichlorobenzene.
| Compound Name | 4-(1-bromopropan-2-yloxy)-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 14773496 |
| Molecular Formula | C9H9BrCl2O |
| Molecular Weight | 283.98 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 4-(1-bromopropan-2-yloxy)-1,2-dichlorobenzene |
| SMILES | CC(CBr)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9BrCl2O/c1-6(5-10)13-7-2-3-8(11)9(12)4-7/h2-4,6H,5H2,1H3 |
| InChIKey | ATIXVEILNLFLNU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.98 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|