C13H19Cl2NO — CID 55076972
2-(3,4-dichlorophenoxy)-N-ethyl-3-methylbutan-1-amine (PubChem CID 55076972) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-ethyl-3-methylbutan-1-amine.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-ethyl-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 55076972 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-ethyl-3-methylbutan-1-amine |
| SMILES | CCNCC(Oc1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C13H19Cl2NO/c1-4-16-8-13(9(2)3)17-10-5-6-11(14)12(15)7-10/h5-7,9,13,16H,4,8H2,1-3H3 |
| InChIKey | ZHVYSGWIIPIGAH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |