C17H28ClNO — CID 63497376
2-(4-chloro-3-ethylphenoxy)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 63497376) has the molecular formula C17H28ClNO and a molecular weight of 297.87 g/mol. Its IUPAC name is 2-(4-chloro-3-ethylphenoxy)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 2-(4-chloro-3-ethylphenoxy)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 63497376 |
| Molecular Formula | C17H28ClNO |
| Molecular Weight | 297.87 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-(4-chloro-3-ethylphenoxy)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CCc1cc(OC(CNCC(C)C)C(C)C)ccc1Cl |
| InChI | InChI=1S/C17H28ClNO/c1-6-14-9-15(7-8-16(14)18)20-17(13(4)5)11-19-10-12(2)3/h7-9,12-13,17,19H,6,10-11H2,1-5H3 |
| InChIKey | HUVIASCSSDTFOU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.87 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |