C11H13Cl2NO3 — CID 78889646
2-(3,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide (PubChem CID 78889646) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 78889646 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)C(=O)NCCO |
| InChI | InChI=1S/C11H13Cl2NO3/c1-7(11(16)14-4-5-15)17-8-2-3-9(12)10(13)6-8/h2-3,6-7,15H,4-5H2,1H3,(H,14,16) |
| InChIKey | XGORLBKYLVTVAR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |