C14H18Cl2N2O4 — CID 122018410
3-[[2-(3,4-dichlorophenoxy)propyl-methylcarbamoyl]amino]propanoic acid (PubChem CID 122018410) has the molecular formula C14H18Cl2N2O4 and a molecular weight of 349.21 g/mol. Its IUPAC name is 3-[[2-(3,4-dichlorophenoxy)propyl-methylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[[2-(3,4-dichlorophenoxy)propyl-methylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122018410 |
| Molecular Formula | C14H18Cl2N2O4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | 3-[[2-(3,4-dichlorophenoxy)propyl-methylcarbamoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)NCCC(=O)O)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O4/c1-9(22-10-3-4-11(15)12(16)7-10)8-18(2)14(21)17-6-5-13(19)20/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | KPUMIIRMHQSAKN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |