C9H9Cl2NOS — CID 61000629
3-(3,4-dichlorophenoxy)propanethioamide (PubChem CID 61000629) has the molecular formula C9H9Cl2NOS and a molecular weight of 250.15 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)propanethioamide.
| Compound Name | 3-(3,4-dichlorophenoxy)propanethioamide |
|---|---|
| PubChem CID | 61000629 |
| Molecular Formula | C9H9Cl2NOS |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)propanethioamide |
| SMILES | NC(=S)CCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NOS/c10-7-2-1-6(5-8(7)11)13-4-3-9(12)14/h1-2,5H,3-4H2,(H2,12,14) |
| InChIKey | YKRQNCGYVOMLHM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|