C10H8Cl2F3NOS — CID 103369133
2-[(3,4-dichlorophenoxy)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369133) has the molecular formula C10H8Cl2F3NOS and a molecular weight of 318.15 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenoxy)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(3,4-dichlorophenoxy)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369133 |
| Molecular Formula | C10H8Cl2F3NOS |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 2-[(3,4-dichlorophenoxy)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(COc1ccc(Cl)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H8Cl2F3NOS/c11-7-2-1-5(3-8(7)12)17-4-6(9(16)18)10(13,14)15/h1-3,6H,4H2,(H2,16,18) |
| InChIKey | NWJKUQBNAXJATR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|