C10H9ClF3NO2S — CID 102724364
2-chloro-4-[2-(trifluoromethoxy)ethoxy]benzenecarbothioamide (PubChem CID 102724364) has the molecular formula C10H9ClF3NO2S and a molecular weight of 299.70 g/mol. Its IUPAC name is 2-chloro-4-[2-(trifluoromethoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 2-chloro-4-[2-(trifluoromethoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 102724364 |
| Molecular Formula | C10H9ClF3NO2S |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-chloro-4-[2-(trifluoromethoxy)ethoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(OCCOC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H9ClF3NO2S/c11-8-5-6(1-2-7(8)9(15)18)16-3-4-17-10(12,13)14/h1-2,5H,3-4H2,(H2,15,18) |
| InChIKey | AFJCYHPTMAZDER-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|