C11H11ClF3NOS — CID 103369023
2-[(4-chloro-2-methylphenoxy)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369023) has the molecular formula C11H11ClF3NOS and a molecular weight of 297.73 g/mol. Its IUPAC name is 2-[(4-chloro-2-methylphenoxy)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(4-chloro-2-methylphenoxy)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369023 |
| Molecular Formula | C11H11ClF3NOS |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[(4-chloro-2-methylphenoxy)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | Cc1cc(Cl)ccc1OCC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C11H11ClF3NOS/c1-6-4-7(12)2-3-9(6)17-5-8(10(16)18)11(13,14)15/h2-4,8H,5H2,1H3,(H2,16,18) |
| InChIKey | FRKTYGZURHTPGA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|