C11H14Cl2O2 — CID 13120346
4-chloro-1-(4-chloro-2-methylphenoxy)butan-2-ol (PubChem CID 13120346) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 4-chloro-1-(4-chloro-2-methylphenoxy)butan-2-ol.
| Compound Name | 4-chloro-1-(4-chloro-2-methylphenoxy)butan-2-ol |
|---|---|
| PubChem CID | 13120346 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 4-chloro-1-(4-chloro-2-methylphenoxy)butan-2-ol |
| SMILES | Cc1cc(Cl)ccc1OCC(O)CCCl |
| InChI | InChI=1S/C11H14Cl2O2/c1-8-6-9(13)2-3-11(8)15-7-10(14)4-5-12/h2-3,6,10,14H,4-5,7H2,1H3 |
| InChIKey | INIFSXSGXVPPCW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|