C14H23Cl2NO4 — CID 44828171
1-[bis(2-hydroxyethyl)amino]-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride (PubChem CID 44828171) has the molecular formula C14H23Cl2NO4 and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44828171 |
| Molecular Formula | C14H23Cl2NO4 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-(4-chloro-2-methylphenoxy)propan-2-ol;hydrochloride |
| SMILES | Cc1cc(Cl)ccc1OCC(O)CN(CCO)CCO.Cl |
| InChI | InChI=1S/C14H22ClNO4.ClH/c1-11-8-12(15)2-3-14(11)20-10-13(19)9-16(4-6-17)5-7-18;/h2-3,8,13,17-19H,4-7,9-10H2,1H3;1H |
| InChIKey | NJGHNLXZHQMWTD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |