C18H31NO3 — CID 41104142
(2S)-1-(4-tert-butyl-2-methylphenoxy)-3-[ethyl(2-hydroxyethyl)amino]propan-2-ol (PubChem CID 41104142) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is (2S)-1-(4-tert-butyl-2-methylphenoxy)-3-[ethyl(2-hydroxyethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-(4-tert-butyl-2-methylphenoxy)-3-[ethyl(2-hydroxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 41104142 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | (2S)-1-(4-tert-butyl-2-methylphenoxy)-3-[ethyl(2-hydroxyethyl)amino]propan-2-ol |
| SMILES | CCN(CCO)C[C@H](O)COc1ccc(C(C)(C)C)cc1C |
| InChI | InChI=1S/C18H31NO3/c1-6-19(9-10-20)12-16(21)13-22-17-8-7-15(11-14(17)2)18(3,4)5/h7-8,11,16,20-21H,6,9-10,12-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | LNANMGAEWQKWLV-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |