C17H28O2 — CID 63467018
1-(4-tert-butyl-2-methylphenoxy)-3,3-dimethylbutan-2-ol (PubChem CID 63467018) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-(4-tert-butyl-2-methylphenoxy)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(4-tert-butyl-2-methylphenoxy)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 63467018 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 1-(4-tert-butyl-2-methylphenoxy)-3,3-dimethylbutan-2-ol |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCC(O)C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-12-10-13(16(2,3)4)8-9-14(12)19-11-15(18)17(5,6)7/h8-10,15,18H,11H2,1-7H3 |
| InChIKey | KMZZXUXKHUCOQW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |