C25H36O3S — CID 89171638
1-[4-[3-[5-(1-methoxyethenyl)thiophen-2-yl]pentan-3-yl]-2-methylphenoxy]-3,3-dimethylbutan-2-ol (PubChem CID 89171638) has the molecular formula C25H36O3S and a molecular weight of 416.63 g/mol. Its IUPAC name is 1-[4-[3-[5-(1-methoxyethenyl)thiophen-2-yl]pentan-3-yl]-2-methylphenoxy]-3,3-dimethylbutan-2-ol.
| Compound Name | 1-[4-[3-[5-(1-methoxyethenyl)thiophen-2-yl]pentan-3-yl]-2-methylphenoxy]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 89171638 |
| Molecular Formula | C25H36O3S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 1-[4-[3-[5-(1-methoxyethenyl)thiophen-2-yl]pentan-3-yl]-2-methylphenoxy]-3,3-dimethylbutan-2-ol |
| SMILES | C=C(OC)c1ccc(C(CC)(CC)c2ccc(OCC(O)C(C)(C)C)c(C)c2)s1 |
| InChI | InChI=1S/C25H36O3S/c1-9-25(10-2,23-14-13-21(29-23)18(4)27-8)19-11-12-20(17(3)15-19)28-16-22(26)24(5,6)7/h11-15,22,26H,4,9-10,16H2,1-3,5-8H3 |
| InChIKey | XDRGCIKOCRMXMB-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|