C29H43NO5 — CID 71616709
N-hydroxy-4-[4-[3-[4-[(2R)-2-hydroxy-3,3-dimethylbutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]butanamide (PubChem CID 71616709) has the molecular formula C29H43NO5 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-hydroxy-4-[4-[3-[4-[(2R)-2-hydroxy-3,3-dimethylbutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]butanamide.
| Compound Name | N-hydroxy-4-[4-[3-[4-[(2R)-2-hydroxy-3,3-dimethylbutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]butanamide |
|---|---|
| PubChem CID | 71616709 |
| Molecular Formula | C29H43NO5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | N-hydroxy-4-[4-[3-[4-[(2R)-2-hydroxy-3,3-dimethylbutoxy]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]butanamide |
| SMILES | CCC(CC)(c1ccc(OCCCC(=O)NO)c(C)c1)c1ccc(OC[C@H](O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C29H43NO5/c1-8-29(9-2,22-12-14-24(20(3)17-22)34-16-10-11-27(32)30-33)23-13-15-25(21(4)18-23)35-19-26(31)28(5,6)7/h12-15,17-18,26,31,33H,8-11,16,19H2,1-7H3,(H,30,32)/t26-/m0/s1 |
| InChIKey | OLOKNJPYMLKDDO-SANMLTNESA-N |
| XLogP | 5.86 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|