C32H47NO5 — CID 157444540
N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]phenyl]-8-oxooctanamide (PubChem CID 157444540) has the molecular formula C32H47NO5 and a molecular weight of 525.73 g/mol. Its IUPAC name is N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]phenyl]-8-oxooctanamide.
| Compound Name | N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]phenyl]-8-oxooctanamide |
|---|---|
| PubChem CID | 157444540 |
| Molecular Formula | C32H47NO5 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.35 |
| IUPAC Name | N-hydroxy-8-[4-[3-[4-(2-hydroxy-3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]phenyl]-8-oxooctanamide |
| SMILES | CCC(CC)(c1ccc(C(=O)CCCCCCC(=O)NO)cc1)c1ccc(OCC(O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C32H47NO5/c1-7-32(8-2,26-19-20-28(23(3)21-26)38-22-29(35)31(4,5)6)25-17-15-24(16-18-25)27(34)13-11-9-10-12-14-30(36)33-37/h15-21,29,35,37H,7-14,22H2,1-6H3,(H,33,36) |
| InChIKey | BSBIIYRKWFTKAC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|