C32H49NO4 — CID 134426097
7-[4-[3-[4-(3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]-N-hydroxyheptanamide (PubChem CID 134426097) has the molecular formula C32H49NO4 and a molecular weight of 511.75 g/mol. Its IUPAC name is 7-[4-[3-[4-(3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]-N-hydroxyheptanamide.
| Compound Name | 7-[4-[3-[4-(3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 134426097 |
| Molecular Formula | C32H49NO4 |
| Molecular Weight | 511.75 g/mol |
| Exact Mass | 511.37 |
| IUPAC Name | 7-[4-[3-[4-(3,3-dimethylbutoxy)-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]-N-hydroxyheptanamide |
| SMILES | CCC(CC)(c1ccc(OCCCCCCC(=O)NO)c(C)c1)c1ccc(OCCC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C32H49NO4/c1-8-32(9-2,27-16-18-29(25(4)23-27)37-21-19-31(5,6)7)26-15-17-28(24(3)22-26)36-20-13-11-10-12-14-30(34)33-35/h15-18,22-23,35H,8-14,19-21H2,1-7H3,(H,33,34) |
| InChIKey | PIYJYYJOSDAUOF-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.75 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|