C24H30ClNaO3 — CID 142923411
sodium 4-[3-[3-chloro-4-(3,3-dimethylbutoxy)phenyl]pentan-3-yl]benzoate (PubChem CID 142923411) has the molecular formula C24H30ClNaO3 and a molecular weight of 424.94 g/mol. Its IUPAC name is sodium 4-[3-[3-chloro-4-(3,3-dimethylbutoxy)phenyl]pentan-3-yl]benzoate.
| Compound Name | sodium 4-[3-[3-chloro-4-(3,3-dimethylbutoxy)phenyl]pentan-3-yl]benzoate |
|---|---|
| PubChem CID | 142923411 |
| Molecular Formula | C24H30ClNaO3 |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | sodium 4-[3-[3-chloro-4-(3,3-dimethylbutoxy)phenyl]pentan-3-yl]benzoate |
| SMILES | CCC(CC)(c1ccc(C(=O)[O-])cc1)c1ccc(OCCC(C)(C)C)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C24H31ClO3.Na/c1-6-24(7-2,18-10-8-17(9-11-18)22(26)27)19-12-13-21(20(25)16-19)28-15-14-23(3,4)5;/h8-13,16H,6-7,14-15H2,1-5H3,(H,26,27);/q;+1/p-1 |
| InChIKey | DPJZEJGAZRTIBP-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |