C12H18ClNO3S — CID 61481232
3-chloro-4-(3,3-dimethylbutoxy)benzenesulfonamide (PubChem CID 61481232) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 3-chloro-4-(3,3-dimethylbutoxy)benzenesulfonamide.
| Compound Name | 3-chloro-4-(3,3-dimethylbutoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 61481232 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-chloro-4-(3,3-dimethylbutoxy)benzenesulfonamide |
| SMILES | CC(C)(C)CCOc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClNO3S/c1-12(2,3)6-7-17-11-5-4-9(8-10(11)13)18(14,15)16/h4-5,8H,6-7H2,1-3H3,(H2,14,15,16) |
| InChIKey | AGXFNIVDRJRQHE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |