C11H14ClNO3S — CID 114473013
3-chloro-4-(3-methylbut-3-enoxy)benzenesulfonamide (PubChem CID 114473013) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 3-chloro-4-(3-methylbut-3-enoxy)benzenesulfonamide.
| Compound Name | 3-chloro-4-(3-methylbut-3-enoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 114473013 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-chloro-4-(3-methylbut-3-enoxy)benzenesulfonamide |
| SMILES | C=C(C)CCOc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C11H14ClNO3S/c1-8(2)5-6-16-11-4-3-9(7-10(11)12)17(13,14)15/h3-4,7H,1,5-6H2,2H3,(H2,13,14,15) |
| InChIKey | GJNAUNIZMVJIFQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|