C12H18ClNO5S2 — CID 106726844
4-(2-tert-butylsulfonylethoxy)-3-chlorobenzenesulfonamide (PubChem CID 106726844) has the molecular formula C12H18ClNO5S2 and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-(2-tert-butylsulfonylethoxy)-3-chlorobenzenesulfonamide.
| Compound Name | 4-(2-tert-butylsulfonylethoxy)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 106726844 |
| Molecular Formula | C12H18ClNO5S2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-(2-tert-butylsulfonylethoxy)-3-chlorobenzenesulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)CCOc1ccc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClNO5S2/c1-12(2,3)20(15,16)7-6-19-11-5-4-9(8-10(11)13)21(14,17)18/h4-5,8H,6-7H2,1-3H3,(H2,14,17,18) |
| InChIKey | CSBOLUDJLMJZLK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |