C14H22ClNO3S — CID 106722525
(1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanamine (PubChem CID 106722525) has the molecular formula C14H22ClNO3S and a molecular weight of 319.85 g/mol. Its IUPAC name is (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanamine.
| Compound Name | (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanamine |
|---|---|
| PubChem CID | 106722525 |
| Molecular Formula | C14H22ClNO3S |
| Molecular Weight | 319.85 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (1R)-1-[4-(2-tert-butylsulfonylethoxy)-3-chlorophenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCCS(=O)(=O)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClNO3S/c1-10(16)11-5-6-13(12(15)9-11)19-7-8-20(17,18)14(2,3)4/h5-6,9-10H,7-8,16H2,1-4H3/t10-/m1/s1 |
| InChIKey | BPMJYOSBJQIRQP-SNVBAGLBSA-N |
| XLogP | 2.95 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.85 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |